C11H22FNO — CID 124862124
(3S,4S)-1-(5-fluoropentyl)-3-methylpiperidin-4-ol (PubChem CID 124862124) has the molecular formula C11H22FNO and a molecular weight of 203.30 g/mol. Its IUPAC name is (3S,4S)-1-(5-fluoropentyl)-3-methylpiperidin-4-ol.
| Compound Name | (3S,4S)-1-(5-fluoropentyl)-3-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 124862124 |
| Molecular Formula | C11H22FNO |
| Molecular Weight | 203.30 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (3S,4S)-1-(5-fluoropentyl)-3-methylpiperidin-4-ol |
| SMILES | C[C@H]1CN(CCCCCF)CC[C@@H]1O |
| InChI | InChI=1S/C11H22FNO/c1-10-9-13(8-5-11(10)14)7-4-2-3-6-12/h10-11,14H,2-9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | LJYVTSWTJAEFRH-QWRGUYRKSA-N |
| XLogP | 1.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|