C12H25NO — CID 115873446
5-(3,4-dimethylpiperidin-1-yl)pentan-1-ol (PubChem CID 115873446) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 5-(3,4-dimethylpiperidin-1-yl)pentan-1-ol.
| Compound Name | 5-(3,4-dimethylpiperidin-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 115873446 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 5-(3,4-dimethylpiperidin-1-yl)pentan-1-ol |
| SMILES | CC1CCN(CCCCCO)CC1C |
| InChI | InChI=1S/C12H25NO/c1-11-6-8-13(10-12(11)2)7-4-3-5-9-14/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | VVCIQQLJDBQSOF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|