About 1-ethylpyrrolidin-3-ol;hydrochloride
1-ethylpyrrolidin-3-ol;hydrochloride (PubChem CID 174666123) has the molecular formula C6H14ClNO
and a molecular weight of 151.64 g/mol. Its IUPAC name is 1-ethylpyrrolidin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-ethylpyrrolidin-3-ol;hydrochloride |
| PubChem CID | 174666123 |
| Molecular Formula | C6H14ClNO |
| Molecular Weight | 151.64 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 1-ethylpyrrolidin-3-ol;hydrochloride |
| SMILES | CCN1CCC(O)C1.Cl |
| InChI | InChI=1S/C6H13NO.ClH/c1-2-7-4-3-6(8)5-7;/h6,8H,2-5H2,1H3;1H |
| InChIKey | VHKREUDJGXPBGQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.64 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethylpyrrolidin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrolidin-3-ol;hydrochloride?
The IUPAC name of 1-ethylpyrrolidin-3-ol;hydrochloride (CID 174666123) is 1-ethylpyrrolidin-3-ol;hydrochloride.
What is the SMILES notation for 1-ethylpyrrolidin-3-ol;hydrochloride?
The canonical SMILES for 1-ethylpyrrolidin-3-ol;hydrochloride is CCN1CCC(O)C1.Cl.
What is the InChIKey of 1-ethylpyrrolidin-3-ol;hydrochloride?
The InChIKey is VHKREUDJGXPBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.ClH/c1-2-7-4-3-6(8)5-7;/h6,8H,2-5H2,1H3;1H.
What are the key properties of 1-ethylpyrrolidin-3-ol;hydrochloride?
1-ethylpyrrolidin-3-ol;hydrochloride has a molecular weight of 151.64 g/mol, XLogP of 0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrolidin-3-ol;hydrochloride is sourced from PubChem (CID 174666123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).