C7H15NO2 — CID 96570686
(3R,5S)-1-ethylpiperidine-3,5-diol (PubChem CID 96570686) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is (3R,5S)-1-ethylpiperidine-3,5-diol.
| Compound Name | (3R,5S)-1-ethylpiperidine-3,5-diol |
|---|---|
| PubChem CID | 96570686 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | (3R,5S)-1-ethylpiperidine-3,5-diol |
| SMILES | CCN1C[C@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C7H15NO2/c1-2-8-4-6(9)3-7(10)5-8/h6-7,9-10H,2-5H2,1H3/t6-,7+ |
| InChIKey | SPSPKIBLEWRJKJ-KNVOCYPGSA-N |
| XLogP | -0.57 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |