About cyclohexane-1,3,5-triol;ethanol
cyclohexane-1,3,5-triol;ethanol (PubChem CID 143582059) has the molecular formula C8H18O4
and a molecular weight of 178.23 g/mol. Its IUPAC name is cyclohexane-1,3,5-triol;ethanol.
Molecular Properties
| Compound Name | cyclohexane-1,3,5-triol;ethanol |
| PubChem CID | 143582059 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | cyclohexane-1,3,5-triol;ethanol |
| SMILES | CCO.OC1CC(O)CC(O)C1 |
| InChI | InChI=1S/C6H12O3.C2H6O/c7-4-1-5(8)3-6(9)2-4;1-2-3/h4-9H,1-3H2;3H,2H2,1H3 |
| InChIKey | KKOHVKCYTPFGIS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexane-1,3,5-triol;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,3,5-triol;ethanol?
The IUPAC name of cyclohexane-1,3,5-triol;ethanol (CID 143582059) is cyclohexane-1,3,5-triol;ethanol.
What is the SMILES notation for cyclohexane-1,3,5-triol;ethanol?
The canonical SMILES for cyclohexane-1,3,5-triol;ethanol is CCO.OC1CC(O)CC(O)C1.
What is the InChIKey of cyclohexane-1,3,5-triol;ethanol?
The InChIKey is KKOHVKCYTPFGIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C2H6O/c7-4-1-5(8)3-6(9)2-4;1-2-3/h4-9H,1-3H2;3H,2H2,1H3.
What are the key properties of cyclohexane-1,3,5-triol;ethanol?
cyclohexane-1,3,5-triol;ethanol has a molecular weight of 178.23 g/mol, XLogP of -0.75, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,3,5-triol;ethanol is sourced from PubChem (CID 143582059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).