C8H18O4 — CID 143582059
cyclohexane-1,3,5-triol;ethanol (PubChem CID 143582059) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is cyclohexane-1,3,5-triol;ethanol.
| Compound Name | cyclohexane-1,3,5-triol;ethanol |
|---|---|
| PubChem CID | 143582059 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | cyclohexane-1,3,5-triol;ethanol |
| SMILES | CCO.OC1CC(O)CC(O)C1 |
| InChI | InChI=1S/C6H12O3.C2H6O/c7-4-1-5(8)3-6(9)2-4;1-2-3/h4-9H,1-3H2;3H,2H2,1H3 |
| InChIKey | KKOHVKCYTPFGIS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |