C6H15BO6 — CID 67659850
boric acid;cyclohexane-1,3,5-triol (PubChem CID 67659850) has the molecular formula C6H15BO6 and a molecular weight of 193.99 g/mol. Its IUPAC name is boric acid;cyclohexane-1,3,5-triol.
| Compound Name | boric acid;cyclohexane-1,3,5-triol |
|---|---|
| PubChem CID | 67659850 |
| Molecular Formula | C6H15BO6 |
| Molecular Weight | 193.99 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | boric acid;cyclohexane-1,3,5-triol |
| SMILES | OB(O)O.OC1CC(O)CC(O)C1 |
| InChI | InChI=1S/C6H12O3.BH3O3/c7-4-1-5(8)3-6(9)2-4;2-1(3)4/h4-9H,1-3H2;2-4H |
| InChIKey | AHYFSZUAJWZNKD-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.99 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|