C6H11ClO2 — CID 143560597
5-chlorocyclohexane-1,3-diol (PubChem CID 143560597) has the molecular formula C6H11ClO2 and a molecular weight of 150.60 g/mol. Its IUPAC name is 5-chlorocyclohexane-1,3-diol.
| Compound Name | 5-chlorocyclohexane-1,3-diol |
|---|---|
| PubChem CID | 143560597 |
| Molecular Formula | C6H11ClO2 |
| Molecular Weight | 150.60 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 5-chlorocyclohexane-1,3-diol |
| SMILES | OC1CC(O)CC(Cl)C1 |
| InChI | InChI=1S/C6H11ClO2/c7-4-1-5(8)3-6(9)2-4/h4-6,8-9H,1-3H2 |
| InChIKey | MFKYYJQOSZKYIJ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.60 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|