C6H12O2 — CID 6950744
trans-(1R,3R)-cyclohexane-1,3-diol (PubChem CID 6950744) has the molecular formula C6H12O2 and a molecular weight of 116.16 g/mol. Its IUPAC name is trans-(1R,3R)-cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 6950744 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | trans-(1R,3R)-cyclohexane-1,3-diol |
| SMILES | O[C@@H]1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C6H12O2/c7-5-2-1-3-6(8)4-5/h5-8H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | RLMGYIOTPQVQJR-PHDIDXHHSA-N |
| XLogP | 0.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |