C6H12CuO2 — CID 68514238
cis-(1S,3R)-cyclohexane-1,3-diol;copper (PubChem CID 68514238) has the molecular formula C6H12CuO2 and a molecular weight of 179.71 g/mol. Its IUPAC name is cis-(1S,3R)-cyclohexane-1,3-diol;copper.
| Compound Name | cis-(1S,3R)-cyclohexane-1,3-diol;copper |
|---|---|
| PubChem CID | 68514238 |
| Molecular Formula | C6H12CuO2 |
| Molecular Weight | 179.71 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | cis-(1S,3R)-cyclohexane-1,3-diol;copper |
| SMILES | O[C@@H]1CCC[C@H](O)C1.[Cu] |
| InChI | InChI=1S/C6H12O2.Cu/c7-5-2-1-3-6(8)4-5;/h5-8H,1-4H2;/t5-,6+; |
| InChIKey | VXQCMEGBESSKID-KNCHESJLSA-N |
| XLogP | 0.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.71 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |