About methanamine;3-methylcyclohexan-1-ol
methanamine;3-methylcyclohexan-1-ol (PubChem CID 174923816) has the molecular formula C8H19NO
and a molecular weight of 145.25 g/mol. Its IUPAC name is methanamine;3-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | methanamine;3-methylcyclohexan-1-ol |
| PubChem CID | 174923816 |
| Molecular Formula | C8H19NO |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | methanamine;3-methylcyclohexan-1-ol |
| SMILES | CC1CCCC(O)C1.CN |
| InChI | InChI=1S/C7H14O.CH5N/c1-6-3-2-4-7(8)5-6;1-2/h6-8H,2-5H2,1H3;2H2,1H3 |
| InChIKey | UGNNHWVVTWGNDN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;3-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;3-methylcyclohexan-1-ol?
The IUPAC name of methanamine;3-methylcyclohexan-1-ol (CID 174923816) is methanamine;3-methylcyclohexan-1-ol.
What is the SMILES notation for methanamine;3-methylcyclohexan-1-ol?
The canonical SMILES for methanamine;3-methylcyclohexan-1-ol is CC1CCCC(O)C1.CN.
What is the InChIKey of methanamine;3-methylcyclohexan-1-ol?
The InChIKey is UGNNHWVVTWGNDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.CH5N/c1-6-3-2-4-7(8)5-6;1-2/h6-8H,2-5H2,1H3;2H2,1H3.
What are the key properties of methanamine;3-methylcyclohexan-1-ol?
methanamine;3-methylcyclohexan-1-ol has a molecular weight of 145.25 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;3-methylcyclohexan-1-ol is sourced from PubChem (CID 174923816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).