About 3-methylcyclopentan-1-ol;yttrium
3-methylcyclopentan-1-ol;yttrium (PubChem CID 178142170) has the molecular formula C6H12OY
and a molecular weight of 189.07 g/mol. Its IUPAC name is 3-methylcyclopentan-1-ol;yttrium.
Molecular Properties
| Compound Name | 3-methylcyclopentan-1-ol;yttrium |
| PubChem CID | 178142170 |
| Molecular Formula | C6H12OY |
| Molecular Weight | 189.07 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 3-methylcyclopentan-1-ol;yttrium |
| SMILES | CC1CCC(O)C1.[Y] |
| InChI | InChI=1S/C6H12O.Y/c1-5-2-3-6(7)4-5;/h5-7H,2-4H2,1H3; |
| InChIKey | BENALCKENVQVNL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.07 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methylcyclopentan-1-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclopentan-1-ol;yttrium?
The IUPAC name of 3-methylcyclopentan-1-ol;yttrium (CID 178142170) is 3-methylcyclopentan-1-ol;yttrium.
What is the SMILES notation for 3-methylcyclopentan-1-ol;yttrium?
The canonical SMILES for 3-methylcyclopentan-1-ol;yttrium is CC1CCC(O)C1.[Y].
What is the InChIKey of 3-methylcyclopentan-1-ol;yttrium?
The InChIKey is BENALCKENVQVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.Y/c1-5-2-3-6(7)4-5;/h5-7H,2-4H2,1H3;.
What are the key properties of 3-methylcyclopentan-1-ol;yttrium?
3-methylcyclopentan-1-ol;yttrium has a molecular weight of 189.07 g/mol, XLogP of 1.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclopentan-1-ol;yttrium is sourced from PubChem (CID 178142170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).