About 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol
3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol (PubChem CID 67930742) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol.
Molecular Properties
| Compound Name | 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol |
| PubChem CID | 67930742 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol |
| SMILES | CC1=NC(O)CO1.CC1CCC(O)C1 |
| InChI | InChI=1S/C6H12O.C4H7NO2/c1-5-2-3-6(7)4-5;1-3-5-4(6)2-7-3/h5-7H,2-4H2,1H3;4,6H,2H2,1H3 |
| InChIKey | NEEWWROZSAIHGP-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol?
The IUPAC name of 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol (CID 67930742) is 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol.
What is the SMILES notation for 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol?
The canonical SMILES for 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol is CC1=NC(O)CO1.CC1CCC(O)C1.
What is the InChIKey of 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol?
The InChIKey is NEEWWROZSAIHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C4H7NO2/c1-5-2-3-6(7)4-5;1-3-5-4(6)2-7-3/h5-7H,2-4H2,1H3;4,6H,2H2,1H3.
What are the key properties of 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol?
3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol has a molecular weight of 201.27 g/mol, XLogP of 0.92, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclopentan-1-ol;2-methyl-4,5-dihydro-1,3-oxazol-4-ol is sourced from PubChem (CID 67930742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).