C15H26O — CID 159051573
4-methylcyclohexan-1-ol;molecular hydrogen;1,4-xylene (PubChem CID 159051573) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 4-methylcyclohexan-1-ol;molecular hydrogen;1,4-xylene.
| Compound Name | 4-methylcyclohexan-1-ol;molecular hydrogen;1,4-xylene |
|---|---|
| PubChem CID | 159051573 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 4-methylcyclohexan-1-ol;molecular hydrogen;1,4-xylene |
| SMILES | CC1CCC(O)CC1.Cc1ccc(C)cc1.[H][H] |
| InChI | InChI=1S/C8H10.C7H14O.H2/c1-7-3-5-8(2)6-4-7;1-6-2-4-7(8)5-3-6;/h3-6H,1-2H3;6-8H,2-5H2,1H3;1H |
| InChIKey | JXIGCDUKZSEJAR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |