About 4-(N,4-dimethylanilino)cyclohexan-1-ol
4-(N,4-dimethylanilino)cyclohexan-1-ol (PubChem CID 114762541) has the molecular formula C14H21NO
and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-(N,4-dimethylanilino)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-(N,4-dimethylanilino)cyclohexan-1-ol |
| PubChem CID | 114762541 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 4-(N,4-dimethylanilino)cyclohexan-1-ol |
| SMILES | Cc1ccc(N(C)C2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C14H21NO/c1-11-3-5-12(6-4-11)15(2)13-7-9-14(16)10-8-13/h3-6,13-14,16H,7-10H2,1-2H3 |
| InChIKey | RYAXGHXGTITQLS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-(N,4-dimethylanilino)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(N,4-dimethylanilino)cyclohexan-1-ol?
The IUPAC name of 4-(N,4-dimethylanilino)cyclohexan-1-ol (CID 114762541) is 4-(N,4-dimethylanilino)cyclohexan-1-ol.
What is the SMILES notation for 4-(N,4-dimethylanilino)cyclohexan-1-ol?
The canonical SMILES for 4-(N,4-dimethylanilino)cyclohexan-1-ol is Cc1ccc(N(C)C2CCC(O)CC2)cc1.
What is the InChIKey of 4-(N,4-dimethylanilino)cyclohexan-1-ol?
The InChIKey is RYAXGHXGTITQLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO/c1-11-3-5-12(6-4-11)15(2)13-7-9-14(16)10-8-13/h3-6,13-14,16H,7-10H2,1-2H3.
What are the key properties of 4-(N,4-dimethylanilino)cyclohexan-1-ol?
4-(N,4-dimethylanilino)cyclohexan-1-ol has a molecular weight of 219.33 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N,4-dimethylanilino)cyclohexan-1-ol is sourced from PubChem (CID 114762541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).