C16H26N2O — CID 117039434
4-(N,4-dimethylanilino)-1-(methylaminomethyl)cyclohexan-1-ol (PubChem CID 117039434) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-(N,4-dimethylanilino)-1-(methylaminomethyl)cyclohexan-1-ol.
| Compound Name | 4-(N,4-dimethylanilino)-1-(methylaminomethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 117039434 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 4-(N,4-dimethylanilino)-1-(methylaminomethyl)cyclohexan-1-ol |
| SMILES | CNCC1(O)CCC(N(C)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C16H26N2O/c1-13-4-6-14(7-5-13)18(3)15-8-10-16(19,11-9-15)12-17-2/h4-7,15,17,19H,8-12H2,1-3H3 |
| InChIKey | NOLLSXXYBNFVED-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|