C14H22N2 — CID 78917483
4-N-methyl-4-N-(4-methylphenyl)cyclohexane-1,4-diamine (PubChem CID 78917483) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-N-methyl-4-N-(4-methylphenyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-methyl-4-N-(4-methylphenyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 78917483 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 4-N-methyl-4-N-(4-methylphenyl)cyclohexane-1,4-diamine |
| SMILES | Cc1ccc(N(C)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C14H22N2/c1-11-3-7-13(8-4-11)16(2)14-9-5-12(15)6-10-14/h3-4,7-8,12,14H,5-6,9-10,15H2,1-2H3 |
| InChIKey | UIBCFEWCSFMNLZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|