C17H26N2OS — CID 170897786
(2S)-N-(4-aminocyclohexyl)-N-methyl-2-(4-methylphenyl)sulfanylpropanamide (PubChem CID 170897786) has the molecular formula C17H26N2OS and a molecular weight of 306.48 g/mol. Its IUPAC name is (2S)-N-(4-aminocyclohexyl)-N-methyl-2-(4-methylphenyl)sulfanylpropanamide.
| Compound Name | (2S)-N-(4-aminocyclohexyl)-N-methyl-2-(4-methylphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 170897786 |
| Molecular Formula | C17H26N2OS |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2S)-N-(4-aminocyclohexyl)-N-methyl-2-(4-methylphenyl)sulfanylpropanamide |
| SMILES | Cc1ccc(S[C@@H](C)C(=O)N(C)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C17H26N2OS/c1-12-4-10-16(11-5-12)21-13(2)17(20)19(3)15-8-6-14(18)7-9-15/h4-5,10-11,13-15H,6-9,18H2,1-3H3/t13-,14?,15?/m0/s1 |
| InChIKey | UERFRUWAXNOHSV-NFOMZHRRSA-N |
| XLogP | 3.20 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |