C20H28N2O2S — CID 154875310
N-methyl-2-(4-methylphenyl)sulfanyl-N-[4-(prop-2-enoylamino)cyclohexyl]propanamide (PubChem CID 154875310) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is N-methyl-2-(4-methylphenyl)sulfanyl-N-[4-(prop-2-enoylamino)cyclohexyl]propanamide.
| Compound Name | N-methyl-2-(4-methylphenyl)sulfanyl-N-[4-(prop-2-enoylamino)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 154875310 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N-methyl-2-(4-methylphenyl)sulfanyl-N-[4-(prop-2-enoylamino)cyclohexyl]propanamide |
| SMILES | C=CC(=O)NC1CCC(N(C)C(=O)C(C)Sc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H28N2O2S/c1-5-19(23)21-16-8-10-17(11-9-16)22(4)20(24)15(3)25-18-12-6-14(2)7-13-18/h5-7,12-13,15-17H,1,8-11H2,2-4H3,(H,21,23) |
| InChIKey | OGLVKFUICVWOCT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|