C16H24N2O — CID 79121701
N-(4-aminocyclohexyl)-N,2,5-trimethylbenzamide (PubChem CID 79121701) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-N,2,5-trimethylbenzamide.
| Compound Name | N-(4-aminocyclohexyl)-N,2,5-trimethylbenzamide |
|---|---|
| PubChem CID | 79121701 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | N-(4-aminocyclohexyl)-N,2,5-trimethylbenzamide |
| SMILES | Cc1ccc(C)c(C(=O)N(C)C2CCC(N)CC2)c1 |
| InChI | InChI=1S/C16H24N2O/c1-11-4-5-12(2)15(10-11)16(19)18(3)14-8-6-13(17)7-9-14/h4-5,10,13-14H,6-9,17H2,1-3H3 |
| InChIKey | NTGVCPFFBLWFFZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |