C15H22N2O — CID 79121288
N-(4-aminocyclohexyl)-N,3-dimethylbenzamide (PubChem CID 79121288) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-N,3-dimethylbenzamide.
| Compound Name | N-(4-aminocyclohexyl)-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 79121288 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-(4-aminocyclohexyl)-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)C2CCC(N)CC2)c1 |
| InChI | InChI=1S/C15H22N2O/c1-11-4-3-5-12(10-11)15(18)17(2)14-8-6-13(16)7-9-14/h3-5,10,13-14H,6-9,16H2,1-2H3 |
| InChIKey | HTNSNLKGWTUSBW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |