About N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide
N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide (PubChem CID 107672162) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide |
| PubChem CID | 107672162 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)N(C)C2CCC(N)CC2)ccc1O |
| InChI | InChI=1S/C15H22N2O2/c1-10-9-11(3-8-14(10)18)15(19)17(2)13-6-4-12(16)5-7-13/h3,8-9,12-13,18H,4-7,16H2,1-2H3 |
| InChIKey | ZOSVXYJFXZSTQC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide?
The IUPAC name of N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide (CID 107672162) is N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide.
What is the SMILES notation for N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide?
The canonical SMILES for N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide is Cc1cc(C(=O)N(C)C2CCC(N)CC2)ccc1O.
What is the InChIKey of N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide?
The InChIKey is ZOSVXYJFXZSTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-10-9-11(3-8-14(10)18)15(19)17(2)13-6-4-12(16)5-7-13/h3,8-9,12-13,18H,4-7,16H2,1-2H3.
What are the key properties of N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide?
N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide has a molecular weight of 262.35 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminocyclohexyl)-4-hydroxy-N,3-dimethylbenzamide is sourced from PubChem (CID 107672162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).