C15H22FNO2 — CID 115149430
4-(4-ethoxy-3-fluoro-N-methylanilino)cyclohexan-1-ol (PubChem CID 115149430) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-(4-ethoxy-3-fluoro-N-methylanilino)cyclohexan-1-ol.
| Compound Name | 4-(4-ethoxy-3-fluoro-N-methylanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 115149430 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-(4-ethoxy-3-fluoro-N-methylanilino)cyclohexan-1-ol |
| SMILES | CCOc1ccc(N(C)C2CCC(O)CC2)cc1F |
| InChI | InChI=1S/C15H22FNO2/c1-3-19-15-9-6-12(10-14(15)16)17(2)11-4-7-13(18)8-5-11/h6,9-11,13,18H,3-5,7-8H2,1-2H3 |
| InChIKey | UJSYXVACYIZOEY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|