C14H23FN2O — CID 115251344
N'-(4-ethoxy-3-fluorophenyl)-2-ethyl-N'-methylpropane-1,3-diamine (PubChem CID 115251344) has the molecular formula C14H23FN2O and a molecular weight of 254.35 g/mol. Its IUPAC name is N'-(4-ethoxy-3-fluorophenyl)-2-ethyl-N'-methylpropane-1,3-diamine.
| Compound Name | N'-(4-ethoxy-3-fluorophenyl)-2-ethyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 115251344 |
| Molecular Formula | C14H23FN2O |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N'-(4-ethoxy-3-fluorophenyl)-2-ethyl-N'-methylpropane-1,3-diamine |
| SMILES | CCOc1ccc(N(C)CC(CC)CN)cc1F |
| InChI | InChI=1S/C14H23FN2O/c1-4-11(9-16)10-17(3)12-6-7-14(18-5-2)13(15)8-12/h6-8,11H,4-5,9-10,16H2,1-3H3 |
| InChIKey | CSWRXUCIYSTYRM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|