About acetonitrile;ethane;4-methylcyclohexan-1-ol
acetonitrile;ethane;4-methylcyclohexan-1-ol (PubChem CID 142088226) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is acetonitrile;ethane;4-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | acetonitrile;ethane;4-methylcyclohexan-1-ol |
| PubChem CID | 142088226 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | acetonitrile;ethane;4-methylcyclohexan-1-ol |
| SMILES | CC.CC#N.CC1CCC(O)CC1 |
| InChI | InChI=1S/C7H14O.C2H3N.C2H6/c1-6-2-4-7(8)5-3-6;1-2-3;1-2/h6-8H,2-5H2,1H3;1H3;1-2H3 |
| InChIKey | WAQBTZHHDYZEGH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;ethane;4-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;ethane;4-methylcyclohexan-1-ol?
The IUPAC name of acetonitrile;ethane;4-methylcyclohexan-1-ol (CID 142088226) is acetonitrile;ethane;4-methylcyclohexan-1-ol.
What is the SMILES notation for acetonitrile;ethane;4-methylcyclohexan-1-ol?
The canonical SMILES for acetonitrile;ethane;4-methylcyclohexan-1-ol is CC.CC#N.CC1CCC(O)CC1.
What is the InChIKey of acetonitrile;ethane;4-methylcyclohexan-1-ol?
The InChIKey is WAQBTZHHDYZEGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C2H3N.C2H6/c1-6-2-4-7(8)5-3-6;1-2-3;1-2/h6-8H,2-5H2,1H3;1H3;1-2H3.
What are the key properties of acetonitrile;ethane;4-methylcyclohexan-1-ol?
acetonitrile;ethane;4-methylcyclohexan-1-ol has a molecular weight of 185.31 g/mol, XLogP of 3.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;ethane;4-methylcyclohexan-1-ol is sourced from PubChem (CID 142088226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).