C8H18O — CID 171838675
cis-(1R,3S)-3-methylcyclopentan-1-ol;ethane (PubChem CID 171838675) has the molecular formula C8H18O and a molecular weight of 130.23 g/mol. Its IUPAC name is cis-(1R,3S)-3-methylcyclopentan-1-ol;ethane.
| Compound Name | cis-(1R,3S)-3-methylcyclopentan-1-ol;ethane |
|---|---|
| PubChem CID | 171838675 |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.14 |
| IUPAC Name | cis-(1R,3S)-3-methylcyclopentan-1-ol;ethane |
| SMILES | CC.C[C@H]1CC[C@@H](O)C1 |
| InChI | InChI=1S/C6H12O.C2H6/c1-5-2-3-6(7)4-5;1-2/h5-7H,2-4H2,1H3;1-2H3/t5-,6+;/m0./s1 |
| InChIKey | MPSAHIBQWGWVTP-RIHPBJNCSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |