C11H22O — CID 130964756
cis-(3S,7R)-3,5,7-trimethylcyclooctan-1-ol (PubChem CID 130964756) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is cis-(3S,7R)-3,5,7-trimethylcyclooctan-1-ol.
| Compound Name | cis-(3S,7R)-3,5,7-trimethylcyclooctan-1-ol |
|---|---|
| PubChem CID | 130964756 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | cis-(3S,7R)-3,5,7-trimethylcyclooctan-1-ol |
| SMILES | CC1C[C@@H](C)CC(O)C[C@@H](C)C1 |
| InChI | InChI=1S/C11H22O/c1-8-4-9(2)6-11(12)7-10(3)5-8/h8-12H,4-7H2,1-3H3/t8?,9-,10+,11? |
| InChIKey | GWIIZARHBAHTIX-GGWWSXTCSA-N |
| XLogP | 2.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |