About formonitrile;1,3,5-trimethylcyclohexane
formonitrile;1,3,5-trimethylcyclohexane (PubChem CID 174384733) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is formonitrile;1,3,5-trimethylcyclohexane.
Molecular Properties
| Compound Name | formonitrile;1,3,5-trimethylcyclohexane |
| PubChem CID | 174384733 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | formonitrile;1,3,5-trimethylcyclohexane |
| SMILES | C#N.CC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C9H18.CHN/c1-7-4-8(2)6-9(3)5-7;1-2/h7-9H,4-6H2,1-3H3;1H |
| InChIKey | GHDHIWSQWFIMQV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze formonitrile;1,3,5-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;1,3,5-trimethylcyclohexane?
The IUPAC name of formonitrile;1,3,5-trimethylcyclohexane (CID 174384733) is formonitrile;1,3,5-trimethylcyclohexane.
What is the SMILES notation for formonitrile;1,3,5-trimethylcyclohexane?
The canonical SMILES for formonitrile;1,3,5-trimethylcyclohexane is C#N.CC1CC(C)CC(C)C1.
What is the InChIKey of formonitrile;1,3,5-trimethylcyclohexane?
The InChIKey is GHDHIWSQWFIMQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.CHN/c1-7-4-8(2)6-9(3)5-7;1-2/h7-9H,4-6H2,1-3H3;1H.
What are the key properties of formonitrile;1,3,5-trimethylcyclohexane?
formonitrile;1,3,5-trimethylcyclohexane has a molecular weight of 153.27 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;1,3,5-trimethylcyclohexane is sourced from PubChem (CID 174384733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).