C10H19N — CID 174384733
formonitrile;1,3,5-trimethylcyclohexane (PubChem CID 174384733) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is formonitrile;1,3,5-trimethylcyclohexane.
| Compound Name | formonitrile;1,3,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 174384733 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | formonitrile;1,3,5-trimethylcyclohexane |
| SMILES | C#N.CC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C9H18.CHN/c1-7-4-8(2)6-9(3)5-7;1-2/h7-9H,4-6H2,1-3H3;1H |
| InChIKey | GHDHIWSQWFIMQV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |