C9H20 — CID 157268000
methane;1,2,4-trimethylcyclopentane (PubChem CID 157268000) has the molecular formula C9H20 and a molecular weight of 128.26 g/mol. Its IUPAC name is methane;1,2,4-trimethylcyclopentane.
| Compound Name | methane;1,2,4-trimethylcyclopentane |
|---|---|
| PubChem CID | 157268000 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | methane;1,2,4-trimethylcyclopentane |
| SMILES | C.CC1CC(C)C(C)C1 |
| InChI | InChI=1S/C8H16.CH4/c1-6-4-7(2)8(3)5-6;/h6-8H,4-5H2,1-3H3;1H4 |
| InChIKey | AYFDCKQCWFXXNZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |