C9H14 — CID 154523020
7-methyltricyclo[3.3.0.02,4]octane (PubChem CID 154523020) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is 7-methyltricyclo[3.3.0.02,4]octane.
| Compound Name | 7-methyltricyclo[3.3.0.02,4]octane |
|---|---|
| PubChem CID | 154523020 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 7-methyltricyclo[3.3.0.02,4]octane |
| SMILES | CC1CC2C(C1)C1CC21 |
| InChI | InChI=1S/C9H14/c1-5-2-6-7(3-5)9-4-8(6)9/h5-9H,2-4H2,1H3 |
| InChIKey | BVDJSXVJBYTGLW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |