C13H20 — CID 162270602
1,3-bis(ethenyl)-5-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 162270602) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 1,3-bis(ethenyl)-5-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 1,3-bis(ethenyl)-5-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 162270602 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 1,3-bis(ethenyl)-5-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | C=CC1CC(C=C)C2CC(C)CC12 |
| InChI | InChI=1S/C13H20/c1-4-10-8-11(5-2)13-7-9(3)6-12(10)13/h4-5,9-13H,1-2,6-8H2,3H3 |
| InChIKey | XSEHYRCVADWMKP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|