C10H14 — CID 143370752
(1S,2R,4S,5R,6S)-6-ethenyltricyclo[3.2.1.02,4]octane (PubChem CID 143370752) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (1S,2R,4S,5R,6S)-6-ethenyltricyclo[3.2.1.02,4]octane.
| Compound Name | (1S,2R,4S,5R,6S)-6-ethenyltricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 143370752 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (1S,2R,4S,5R,6S)-6-ethenyltricyclo[3.2.1.02,4]octane |
| SMILES | C=C[C@@H]1C[C@H]2C[C@H]1[C@H]1C[C@H]21 |
| InChI | InChI=1S/C10H14/c1-2-6-3-7-4-8(6)10-5-9(7)10/h2,6-10H,1,3-5H2/t6-,7+,8-,9-,10-/m1/s1 |
| InChIKey | YFKUVBSXJFQLLL-JDDHQFAOSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|