C9H13BrO — CID 134612491
3-bromo-5-ethenylbicyclo[2.2.1]heptan-2-ol (PubChem CID 134612491) has the molecular formula C9H13BrO and a molecular weight of 217.11 g/mol. Its IUPAC name is 3-bromo-5-ethenylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 3-bromo-5-ethenylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 134612491 |
| Molecular Formula | C9H13BrO |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | 3-bromo-5-ethenylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=CC1CC2CC1C(Br)C2O |
| InChI | InChI=1S/C9H13BrO/c1-2-5-3-6-4-7(5)8(10)9(6)11/h2,5-9,11H,1,3-4H2 |
| InChIKey | MWDDSSVDNXRNGR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|