C16H18O — CID 162740070
14-ethenyl-3-oxatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8-triene (PubChem CID 162740070) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 14-ethenyl-3-oxatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8-triene.
| Compound Name | 14-ethenyl-3-oxatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8-triene |
|---|---|
| PubChem CID | 162740070 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 14-ethenyl-3-oxatetracyclo[10.2.1.02,11.04,9]pentadeca-4,6,8-triene |
| SMILES | C=CC1CC2CC1C1Oc3ccccc3CC21 |
| InChI | InChI=1S/C16H18O/c1-2-10-7-12-9-13(10)16-14(12)8-11-5-3-4-6-15(11)17-16/h2-6,10,12-14,16H,1,7-9H2 |
| InChIKey | FWGQAAMWXZKVDS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|