C16H14O4 — CID 5314107
13-methoxy-2-oxatetracyclo[8.6.0.03,8.011,16]hexadeca-3,5,7,13-tetraene-12,15-dione (PubChem CID 5314107) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 13-methoxy-2-oxatetracyclo[8.6.0.03,8.011,16]hexadeca-3,5,7,13-tetraene-12,15-dione.
| Compound Name | 13-methoxy-2-oxatetracyclo[8.6.0.03,8.011,16]hexadeca-3,5,7,13-tetraene-12,15-dione |
|---|---|
| PubChem CID | 5314107 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 13-methoxy-2-oxatetracyclo[8.6.0.03,8.011,16]hexadeca-3,5,7,13-tetraene-12,15-dione |
| SMILES | COC1=CC(=O)C2C3Oc4ccccc4CC3C2C1=O |
| InChI | InChI=1S/C16H14O4/c1-19-12-7-10(17)14-13(15(12)18)9-6-8-4-2-3-5-11(8)20-16(9)14/h2-5,7,9,13-14,16H,6H2,1H3 |
| InChIKey | SRXPNCRZUAJXRR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |