C11H12O3 — CID 163392607
(2S,3R)-3-methyl-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 163392607) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (2S,3R)-3-methyl-3,4-dihydro-2H-chromene-2-carboxylic acid.
| Compound Name | (2S,3R)-3-methyl-3,4-dihydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 163392607 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (2S,3R)-3-methyl-3,4-dihydro-2H-chromene-2-carboxylic acid |
| SMILES | C[C@@H]1Cc2ccccc2O[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H12O3/c1-7-6-8-4-2-3-5-9(8)14-10(7)11(12)13/h2-5,7,10H,6H2,1H3,(H,12,13)/t7-,10+/m1/s1 |
| InChIKey | PREGCKDNVYMUID-XCBNKYQSSA-N |
| XLogP | 1.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |