(2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid

C16H14O3 — CID 10658583

IUPAC(2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid
SMILESO=C(O)[C@H]1Oc2ccccc2C[C@H]1c1ccccc1
InChIInChI=1S/C16H14O3/c17-16(18)15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-14(12)19-15/h1-9,13,15H,10H2,(H,17,18)/t13-,15-/m0/s1
InChIKeyFRACQCVHMUPCIS-ZFWWWQNUSA-N
MW254.29 g/mol
LogP2.86
Rot. Bonds2

About (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid

(2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 10658583) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid.

Molecular Properties

Compound Name(2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid
PubChem CID10658583
Molecular FormulaC16H14O3
Molecular Weight254.29 g/mol
Exact Mass254.09
IUPAC Name(2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid
SMILESO=C(O)[C@H]1Oc2ccccc2C[C@H]1c1ccccc1
InChIInChI=1S/C16H14O3/c17-16(18)15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-14(12)19-15/h1-9,13,15H,10H2,(H,17,18)/t13-,15-/m0/s1
InChIKeyFRACQCVHMUPCIS-ZFWWWQNUSA-N
XLogP2.86
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 52.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid?
The IUPAC name of (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid (CID 10658583) is (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid.
What is the SMILES notation for (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid?
The canonical SMILES for (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid is O=C(O)[C@H]1Oc2ccccc2C[C@H]1c1ccccc1.
What is the InChIKey of (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid?
The InChIKey is FRACQCVHMUPCIS-ZFWWWQNUSA-N. The full InChI is InChI=1S/C16H14O3/c17-16(18)15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-14(12)19-15/h1-9,13,15H,10H2,(H,17,18)/t13-,15-/m0/s1.
What are the key properties of (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid?
(2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid has a molecular weight of 254.29 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid is sourced from PubChem (CID 10658583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).