C16H14O3 — CID 10658583
(2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid (PubChem CID 10658583) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid.
| Compound Name | (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 10658583 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2S,3S)-3-phenyl-3,4-dihydro-2H-chromene-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1Oc2ccccc2C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H14O3/c17-16(18)15-13(11-6-2-1-3-7-11)10-12-8-4-5-9-14(12)19-15/h1-9,13,15H,10H2,(H,17,18)/t13-,15-/m0/s1 |
| InChIKey | FRACQCVHMUPCIS-ZFWWWQNUSA-N |
| XLogP | 2.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |