C15H13BrO — CID 71410185
(2S,3S)-3-bromo-2-phenyl-3,4-dihydro-2H-chromene (PubChem CID 71410185) has the molecular formula C15H13BrO and a molecular weight of 289.17 g/mol. Its IUPAC name is (2S,3S)-3-bromo-2-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | (2S,3S)-3-bromo-2-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 71410185 |
| Molecular Formula | C15H13BrO |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (2S,3S)-3-bromo-2-phenyl-3,4-dihydro-2H-chromene |
| SMILES | Br[C@H]1Cc2ccccc2O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H13BrO/c16-13-10-12-8-4-5-9-14(12)17-15(13)11-6-2-1-3-7-11/h1-9,13,15H,10H2/t13-,15-/m0/s1 |
| InChIKey | INJYKLDBVVBBFQ-ZFWWWQNUSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|