C22H20O2 — CID 138963774
(2S,3R)-2-(4-methoxyphenyl)-3-phenyl-3,4-dihydro-2H-chromene (PubChem CID 138963774) has the molecular formula C22H20O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is (2S,3R)-2-(4-methoxyphenyl)-3-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | (2S,3R)-2-(4-methoxyphenyl)-3-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 138963774 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (2S,3R)-2-(4-methoxyphenyl)-3-phenyl-3,4-dihydro-2H-chromene |
| SMILES | COc1ccc([C@H]2Oc3ccccc3C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20O2/c1-23-19-13-11-17(12-14-19)22-20(16-7-3-2-4-8-16)15-18-9-5-6-10-21(18)24-22/h2-14,20,22H,15H2,1H3/t20-,22-/m1/s1 |
| InChIKey | BBQLDXRXKWFIEA-IFMALSPDSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |