C12H13NO2 — CID 90190601
(Z)-2-(2,3-dihydro-1-benzofuran-2-yl)but-2-enamide (PubChem CID 90190601) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (Z)-2-(2,3-dihydro-1-benzofuran-2-yl)but-2-enamide.
| Compound Name | (Z)-2-(2,3-dihydro-1-benzofuran-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 90190601 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (Z)-2-(2,3-dihydro-1-benzofuran-2-yl)but-2-enamide |
| SMILES | C/C=C(\C(N)=O)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C12H13NO2/c1-2-9(12(13)14)11-7-8-5-3-4-6-10(8)15-11/h2-6,11H,7H2,1H3,(H2,13,14)/b9-2- |
| InChIKey | YIBBEVACAJNHGZ-MBXJOHMKSA-N |
| XLogP | 1.42 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|