About (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol
(2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol (PubChem CID 168762985) has the molecular formula C13H12O3
and a molecular weight of 216.24 g/mol. Its IUPAC name is (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol.
Molecular Properties
| Compound Name | (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol |
| PubChem CID | 168762985 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol |
| SMILES | O[C@H]1Cc2ccccc2O[C@@H]1c1ccco1 |
| InChI | InChI=1S/C13H12O3/c14-10-8-9-4-1-2-5-11(9)16-13(10)12-6-3-7-15-12/h1-7,10,13-14H,8H2/t10-,13-/m0/s1 |
| InChIKey | USTPJYPUALCSPE-GWCFXTLKSA-N |
| XLogP | 2.32 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol?
The IUPAC name of (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol (CID 168762985) is (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol.
What is the SMILES notation for (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol?
The canonical SMILES for (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol is O[C@H]1Cc2ccccc2O[C@@H]1c1ccco1.
What is the InChIKey of (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol?
The InChIKey is USTPJYPUALCSPE-GWCFXTLKSA-N. The full InChI is InChI=1S/C13H12O3/c14-10-8-9-4-1-2-5-11(9)16-13(10)12-6-3-7-15-12/h1-7,10,13-14H,8H2/t10-,13-/m0/s1.
What are the key properties of (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol?
(2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol has a molecular weight of 216.24 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol is sourced from PubChem (CID 168762985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).