C13H12O3 — CID 168762985
(2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol (PubChem CID 168762985) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol.
| Compound Name | (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol |
|---|---|
| PubChem CID | 168762985 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (2S,3S)-2-(furan-2-yl)-3,4-dihydro-2H-chromen-3-ol |
| SMILES | O[C@H]1Cc2ccccc2O[C@@H]1c1ccco1 |
| InChI | InChI=1S/C13H12O3/c14-10-8-9-4-1-2-5-11(9)16-13(10)12-6-3-7-15-12/h1-7,10,13-14H,8H2/t10-,13-/m0/s1 |
| InChIKey | USTPJYPUALCSPE-GWCFXTLKSA-N |
| XLogP | 2.32 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |