C8H12O — CID 162077883
(1S,5R)-3-methylbicyclo[3.1.0]hexane-6-carbaldehyde (PubChem CID 162077883) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (1S,5R)-3-methylbicyclo[3.1.0]hexane-6-carbaldehyde.
| Compound Name | (1S,5R)-3-methylbicyclo[3.1.0]hexane-6-carbaldehyde |
|---|---|
| PubChem CID | 162077883 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (1S,5R)-3-methylbicyclo[3.1.0]hexane-6-carbaldehyde |
| SMILES | CC1C[C@@H]2C(C=O)[C@@H]2C1 |
| InChI | InChI=1S/C8H12O/c1-5-2-6-7(3-5)8(6)4-9/h4-8H,2-3H2,1H3/t5?,6-,7+,8? |
| InChIKey | KEAIWHMVHFGCNF-XSHWGTKXSA-N |
| XLogP | 1.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|