C5H7BrO — CID 101345044
(1S,2R,3S)-2-bromo-3-methylcyclopropane-1-carbaldehyde (PubChem CID 101345044) has the molecular formula C5H7BrO and a molecular weight of 163.01 g/mol. Its IUPAC name is (1S,2R,3S)-2-bromo-3-methylcyclopropane-1-carbaldehyde.
| Compound Name | (1S,2R,3S)-2-bromo-3-methylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 101345044 |
| Molecular Formula | C5H7BrO |
| Molecular Weight | 163.01 g/mol |
| Exact Mass | 161.97 |
| IUPAC Name | (1S,2R,3S)-2-bromo-3-methylcyclopropane-1-carbaldehyde |
| SMILES | C[C@@H]1[C@@H](Br)[C@@H]1C=O |
| InChI | InChI=1S/C5H7BrO/c1-3-4(2-7)5(3)6/h2-5H,1H3/t3-,4+,5+/m0/s1 |
| InChIKey | PVTMFVWXUJEOAU-VPENINKCSA-N |
| XLogP | 1.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.01 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|