C9H14O2 — CID 14243904
trans-(2R,6R)-2,6-dimethyl-4-oxocyclohexane-1-carbaldehyde (PubChem CID 14243904) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is trans-(2R,6R)-2,6-dimethyl-4-oxocyclohexane-1-carbaldehyde.
| Compound Name | trans-(2R,6R)-2,6-dimethyl-4-oxocyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 14243904 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | trans-(2R,6R)-2,6-dimethyl-4-oxocyclohexane-1-carbaldehyde |
| SMILES | C[C@@H]1CC(=O)C[C@@H](C)C1C=O |
| InChI | InChI=1S/C9H14O2/c1-6-3-8(11)4-7(2)9(6)5-10/h5-7,9H,3-4H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | NRSYUBVYCBWQIS-RNFRBKRXSA-N |
| XLogP | 1.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|