C14H24O2 — CID 133065506
butan-2-one;2,4,6-trimethylcyclohex-3-ene-1-carbaldehyde (PubChem CID 133065506) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is butan-2-one;2,4,6-trimethylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | butan-2-one;2,4,6-trimethylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 133065506 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | butan-2-one;2,4,6-trimethylcyclohex-3-ene-1-carbaldehyde |
| SMILES | CC1=CC(C)C(C=O)C(C)C1.CCC(C)=O |
| InChI | InChI=1S/C10H16O.C4H8O/c1-7-4-8(2)10(6-11)9(3)5-7;1-3-4(2)5/h4,6,8-10H,5H2,1-3H3;3H2,1-2H3 |
| InChIKey | DFMKTPQXPWVNAK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|