C17H32NO2+ — CID 11889053
diethyl-methyl-[2-oxo-2-[[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methoxy]ethyl]azanium (PubChem CID 11889053) has the molecular formula C17H32NO2+ and a molecular weight of 282.45 g/mol. Its IUPAC name is diethyl-methyl-[2-oxo-2-[[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methoxy]ethyl]azanium.
| Compound Name | diethyl-methyl-[2-oxo-2-[[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methoxy]ethyl]azanium |
|---|---|
| PubChem CID | 11889053 |
| Molecular Formula | C17H32NO2+ |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | diethyl-methyl-[2-oxo-2-[[(1R,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methoxy]ethyl]azanium |
| SMILES | CC[N+](C)(CC)CC(=O)OC[C@@H]1[C@H](C)CC(C)=C[C@@H]1C |
| InChI | InChI=1S/C17H32NO2/c1-7-18(6,8-2)11-17(19)20-12-16-14(4)9-13(3)10-15(16)5/h9,14-16H,7-8,10-12H2,1-6H3/q+1/t14-,15+,16-/m0/s1 |
| InChIKey | XPZFSIWXSZKPNH-XHSDSOJGSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|