C10H16O2 — CID 89187199
2-[(1S,2R)-2,4-dimethylcyclohex-3-en-1-yl]acetic acid (PubChem CID 89187199) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-[(1S,2R)-2,4-dimethylcyclohex-3-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,2R)-2,4-dimethylcyclohex-3-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 89187199 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-[(1S,2R)-2,4-dimethylcyclohex-3-en-1-yl]acetic acid |
| SMILES | CC1=C[C@H](C)[C@H](CC(=O)O)CC1 |
| InChI | InChI=1S/C10H16O2/c1-7-3-4-9(6-10(11)12)8(2)5-7/h5,8-9H,3-4,6H2,1-2H3,(H,11,12)/t8-,9-/m0/s1 |
| InChIKey | AAZSHRNENBBJDK-IUCAKERBSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|