C8H14O2S — CID 163733260
2,4-dimethylcyclohex-3-ene-1-sulfinic acid (PubChem CID 163733260) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is 2,4-dimethylcyclohex-3-ene-1-sulfinic acid.
| Compound Name | 2,4-dimethylcyclohex-3-ene-1-sulfinic acid |
|---|---|
| PubChem CID | 163733260 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2,4-dimethylcyclohex-3-ene-1-sulfinic acid |
| SMILES | CC1=CC(C)C(S(=O)O)CC1 |
| InChI | InChI=1S/C8H14O2S/c1-6-3-4-8(11(9)10)7(2)5-6/h5,7-8H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | FGJKFMAMOUOMMW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|