C10H17F — CID 146579921
5-fluoro-1,3,4-trimethylcycloheptene (PubChem CID 146579921) has the molecular formula C10H17F and a molecular weight of 156.24 g/mol. Its IUPAC name is 5-fluoro-1,3,4-trimethylcycloheptene.
| Compound Name | 5-fluoro-1,3,4-trimethylcycloheptene |
|---|---|
| PubChem CID | 146579921 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 5-fluoro-1,3,4-trimethylcycloheptene |
| SMILES | CC1=CC(C)C(C)C(F)CC1 |
| InChI | InChI=1S/C10H17F/c1-7-4-5-10(11)9(3)8(2)6-7/h6,8-10H,4-5H2,1-3H3 |
| InChIKey | BADIRPNMEWEFQH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|