About 5-fluoro-1,3,4-trimethylcycloheptene
5-fluoro-1,3,4-trimethylcycloheptene (PubChem CID 146579921) has the molecular formula C10H17F
and a molecular weight of 156.24 g/mol. Its IUPAC name is 5-fluoro-1,3,4-trimethylcycloheptene.
Molecular Properties
| Compound Name | 5-fluoro-1,3,4-trimethylcycloheptene |
| PubChem CID | 146579921 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 5-fluoro-1,3,4-trimethylcycloheptene |
| SMILES | CC1=CC(C)C(C)C(F)CC1 |
| InChI | InChI=1S/C10H17F/c1-7-4-5-10(11)9(3)8(2)6-7/h6,8-10H,4-5H2,1-3H3 |
| InChIKey | BADIRPNMEWEFQH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1,3,4-trimethylcycloheptene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1,3,4-trimethylcycloheptene?
The IUPAC name of 5-fluoro-1,3,4-trimethylcycloheptene (CID 146579921) is 5-fluoro-1,3,4-trimethylcycloheptene.
What is the SMILES notation for 5-fluoro-1,3,4-trimethylcycloheptene?
The canonical SMILES for 5-fluoro-1,3,4-trimethylcycloheptene is CC1=CC(C)C(C)C(F)CC1.
What is the InChIKey of 5-fluoro-1,3,4-trimethylcycloheptene?
The InChIKey is BADIRPNMEWEFQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F/c1-7-4-5-10(11)9(3)8(2)6-7/h6,8-10H,4-5H2,1-3H3.
What are the key properties of 5-fluoro-1,3,4-trimethylcycloheptene?
5-fluoro-1,3,4-trimethylcycloheptene has a molecular weight of 156.24 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1,3,4-trimethylcycloheptene is sourced from PubChem (CID 146579921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).