C10H18OS — CID 20651669
1,3,4-trimethyl-5-methylsulfinylcyclohexene (PubChem CID 20651669) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is 1,3,4-trimethyl-5-methylsulfinylcyclohexene.
| Compound Name | 1,3,4-trimethyl-5-methylsulfinylcyclohexene |
|---|---|
| PubChem CID | 20651669 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 1,3,4-trimethyl-5-methylsulfinylcyclohexene |
| SMILES | CC1=CC(C)C(C)C(S(C)=O)C1 |
| InChI | InChI=1S/C10H18OS/c1-7-5-8(2)9(3)10(6-7)12(4)11/h5,8-10H,6H2,1-4H3 |
| InChIKey | GYQPRDPDVXBVOS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|