C25H30O3 — CID 175023077
benzyl 2-phenylacetate;2-(2,4-dimethylcyclohex-3-en-1-yl)acetaldehyde (PubChem CID 175023077) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is benzyl 2-phenylacetate;2-(2,4-dimethylcyclohex-3-en-1-yl)acetaldehyde.
| Compound Name | benzyl 2-phenylacetate;2-(2,4-dimethylcyclohex-3-en-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 175023077 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | benzyl 2-phenylacetate;2-(2,4-dimethylcyclohex-3-en-1-yl)acetaldehyde |
| SMILES | CC1=CC(C)C(CC=O)CC1.O=C(Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C15H14O2.C10H16O/c16-15(11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14;1-8-3-4-10(5-6-11)9(2)7-8/h1-10H,11-12H2;6-7,9-10H,3-5H2,1-2H3 |
| InChIKey | YUAHXPDIBUXEJX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|